C13H17Cl2N3O — CID 126422673
(3R)-3-amino-N-[(2,4-dichlorophenyl)methyl]piperidine-1-carboxamide (PubChem CID 126422673) has the molecular formula C13H17Cl2N3O and a molecular weight of 302.20 g/mol. Its IUPAC name is (3R)-3-amino-N-[(2,4-dichlorophenyl)methyl]piperidine-1-carboxamide.
| Compound Name | (3R)-3-amino-N-[(2,4-dichlorophenyl)methyl]piperidine-1-carboxamide |
|---|---|
| PubChem CID | 126422673 |
| Molecular Formula | C13H17Cl2N3O |
| Molecular Weight | 302.20 g/mol |
| Exact Mass | 301.07 |
| IUPAC Name | (3R)-3-amino-N-[(2,4-dichlorophenyl)methyl]piperidine-1-carboxamide |
| SMILES | N[C@@H]1CCCN(C(=O)NCc2ccc(Cl)cc2Cl)C1 |
| InChI | InChI=1S/C13H17Cl2N3O/c14-10-4-3-9(12(15)6-10)7-17-13(19)18-5-1-2-11(16)8-18/h3-4,6,11H,1-2,5,7-8,16H2,(H,17,19)/t11-/m1/s1 |
| InChIKey | UPKFNVALDIWPMD-LLVKDONJSA-N |
| XLogP | 2.63 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.20 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |