C13H16Cl2N2OS — CID 119378981
1-(3-aminopiperidin-1-yl)-2-(2,5-dichlorophenyl)sulfanylethanone (PubChem CID 119378981) has the molecular formula C13H16Cl2N2OS and a molecular weight of 319.26 g/mol. Its IUPAC name is 1-(3-aminopiperidin-1-yl)-2-(2,5-dichlorophenyl)sulfanylethanone.
| Compound Name | 1-(3-aminopiperidin-1-yl)-2-(2,5-dichlorophenyl)sulfanylethanone |
|---|---|
| PubChem CID | 119378981 |
| Molecular Formula | C13H16Cl2N2OS |
| Molecular Weight | 319.26 g/mol |
| Exact Mass | 318.04 |
| IUPAC Name | 1-(3-aminopiperidin-1-yl)-2-(2,5-dichlorophenyl)sulfanylethanone |
| SMILES | NC1CCCN(C(=O)CSc2cc(Cl)ccc2Cl)C1 |
| InChI | InChI=1S/C13H16Cl2N2OS/c14-9-3-4-11(15)12(6-9)19-8-13(18)17-5-1-2-10(16)7-17/h3-4,6,10H,1-2,5,7-8,16H2 |
| InChIKey | KTZXSBOQBKCQNU-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.26 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |