C19H21Cl2NO2S2 — CID 99957408
(2S)-N-[2-[(2,4-dichlorophenyl)methylsulfanyl]ethyl]-2-(4-methoxyphenyl)sulfanylpropanamide (PubChem CID 99957408) has the molecular formula C19H21Cl2NO2S2 and a molecular weight of 430.42 g/mol. Its IUPAC name is (2S)-N-[2-[(2,4-dichlorophenyl)methylsulfanyl]ethyl]-2-(4-methoxyphenyl)sulfanylpropanamide.
| Compound Name | (2S)-N-[2-[(2,4-dichlorophenyl)methylsulfanyl]ethyl]-2-(4-methoxyphenyl)sulfanylpropanamide |
|---|---|
| PubChem CID | 99957408 |
| Molecular Formula | C19H21Cl2NO2S2 |
| Molecular Weight | 430.42 g/mol |
| Exact Mass | 429.04 |
| IUPAC Name | (2S)-N-[2-[(2,4-dichlorophenyl)methylsulfanyl]ethyl]-2-(4-methoxyphenyl)sulfanylpropanamide |
| SMILES | COc1ccc(S[C@@H](C)C(=O)NCCSCc2ccc(Cl)cc2Cl)cc1 |
| InChI | InChI=1S/C19H21Cl2NO2S2/c1-13(26-17-7-5-16(24-2)6-8-17)19(23)22-9-10-25-12-14-3-4-15(20)11-18(14)21/h3-8,11,13H,9-10,12H2,1-2H3,(H,22,23)/t13-/m0/s1 |
| InChIKey | CZKLVSZFOUKQRM-ZDUSSCGKSA-N |
| XLogP | 5.53 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.42 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|