C13H16ClFO2S — CID 117098066
6-[(4-chloro-2-fluorophenyl)methylsulfanyl]hexanoic acid (PubChem CID 117098066) has the molecular formula C13H16ClFO2S and a molecular weight of 290.79 g/mol. Its IUPAC name is 6-[(4-chloro-2-fluorophenyl)methylsulfanyl]hexanoic acid.
| Compound Name | 6-[(4-chloro-2-fluorophenyl)methylsulfanyl]hexanoic acid |
|---|---|
| PubChem CID | 117098066 |
| Molecular Formula | C13H16ClFO2S |
| Molecular Weight | 290.79 g/mol |
| Exact Mass | 290.05 |
| IUPAC Name | 6-[(4-chloro-2-fluorophenyl)methylsulfanyl]hexanoic acid |
| SMILES | O=C(O)CCCCCSCc1ccc(Cl)cc1F |
| InChI | InChI=1S/C13H16ClFO2S/c14-11-6-5-10(12(15)8-11)9-18-7-3-1-2-4-13(16)17/h5-6,8H,1-4,7,9H2,(H,16,17) |
| InChIKey | ALYTWQCRRLDKDI-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.79 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|