C13H14ClFO2S — CID 114847713
2-[1-[(4-chloro-2-fluorophenyl)methylsulfanylmethyl]cyclopropyl]acetic acid (PubChem CID 114847713) has the molecular formula C13H14ClFO2S and a molecular weight of 288.77 g/mol. Its IUPAC name is 2-[1-[(4-chloro-2-fluorophenyl)methylsulfanylmethyl]cyclopropyl]acetic acid.
| Compound Name | 2-[1-[(4-chloro-2-fluorophenyl)methylsulfanylmethyl]cyclopropyl]acetic acid |
|---|---|
| PubChem CID | 114847713 |
| Molecular Formula | C13H14ClFO2S |
| Molecular Weight | 288.77 g/mol |
| Exact Mass | 288.04 |
| IUPAC Name | 2-[1-[(4-chloro-2-fluorophenyl)methylsulfanylmethyl]cyclopropyl]acetic acid |
| SMILES | O=C(O)CC1(CSCc2ccc(Cl)cc2F)CC1 |
| InChI | InChI=1S/C13H14ClFO2S/c14-10-2-1-9(11(15)5-10)7-18-8-13(3-4-13)6-12(16)17/h1-2,5H,3-4,6-8H2,(H,16,17) |
| InChIKey | XMTVEIORACCESY-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.77 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |