C12H13Cl2NO2S — CID 106993404
2-[1-[(2,6-dichloro-3-pyridinyl)methylsulfanylmethyl]cyclopropyl]acetic acid (PubChem CID 106993404) has the molecular formula C12H13Cl2NO2S and a molecular weight of 306.21 g/mol. Its IUPAC name is 2-[1-[(2,6-dichloro-3-pyridinyl)methylsulfanylmethyl]cyclopropyl]acetic acid.
| Compound Name | 2-[1-[(2,6-dichloro-3-pyridinyl)methylsulfanylmethyl]cyclopropyl]acetic acid |
|---|---|
| PubChem CID | 106993404 |
| Molecular Formula | C12H13Cl2NO2S |
| Molecular Weight | 306.21 g/mol |
| Exact Mass | 305.00 |
| IUPAC Name | 2-[1-[(2,6-dichloro-3-pyridinyl)methylsulfanylmethyl]cyclopropyl]acetic acid |
| SMILES | O=C(O)CC1(CSCc2ccc(Cl)nc2Cl)CC1 |
| InChI | InChI=1S/C12H13Cl2NO2S/c13-9-2-1-8(11(14)15-9)6-18-7-12(3-4-12)5-10(16)17/h1-2H,3-7H2,(H,16,17) |
| InChIKey | ZWFVUSGWFOTTRI-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.21 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|