C16H17NO2S — CID 65441723
2-[1-(Quinolin-6-ylmethylsulfanylmethyl)cyclopropyl]acetic acid (PubChem CID 65441723) has the molecular formula C16H17NO2S and a molecular weight of 287.40 g/mol. Its IUPAC name is 2-[1-(quinolin-6-ylmethylsulfanylmethyl)cyclopropyl]acetic acid.
| Compound Name | 2-[1-(Quinolin-6-ylmethylsulfanylmethyl)cyclopropyl]acetic acid |
|---|---|
| PubChem CID | 65441723 |
| Molecular Formula | C16H17NO2S |
| Molecular Weight | 287.40 g/mol |
| Exact Mass | 287.10 |
| IUPAC Name | 2-[1-(quinolin-6-ylmethylsulfanylmethyl)cyclopropyl]acetic acid |
| SMILES | C1CC1(CC(=O)O)CSCC2=CC3=C(C=C2)N=CC=C3 |
| InChI | InChI=1S/C16H17NO2S/c18-15(19)9-16(5-6-16)11-20-10-12-3-4-14-13(8-12)2-1-7-17-14/h1-4,7-8H,5-6,9-11H2,(H,18,19) |
| InChIKey | ORMRNIRTXAXQFD-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 75.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | 356 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.40 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |