C13H14BrFO2S — CID 65441515
2-[1-[(3-bromo-4-fluorophenyl)methylsulfanylmethyl]cyclopropyl]acetic acid (PubChem CID 65441515) has the molecular formula C13H14BrFO2S and a molecular weight of 333.22 g/mol. Its IUPAC name is 2-[1-[(3-bromo-4-fluorophenyl)methylsulfanylmethyl]cyclopropyl]acetic acid.
| Compound Name | 2-[1-[(3-bromo-4-fluorophenyl)methylsulfanylmethyl]cyclopropyl]acetic acid |
|---|---|
| PubChem CID | 65441515 |
| Molecular Formula | C13H14BrFO2S |
| Molecular Weight | 333.22 g/mol |
| Exact Mass | 331.99 |
| IUPAC Name | 2-[1-[(3-bromo-4-fluorophenyl)methylsulfanylmethyl]cyclopropyl]acetic acid |
| SMILES | O=C(O)CC1(CSCc2ccc(F)c(Br)c2)CC1 |
| InChI | InChI=1S/C13H14BrFO2S/c14-10-5-9(1-2-11(10)15)7-18-8-13(3-4-13)6-12(16)17/h1-2,5H,3-4,6-8H2,(H,16,17) |
| InChIKey | ISPFLYICHLRNBU-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.22 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |