C14H16ClFO2S — CID 114000181
methyl 2-[1-[(3-chloro-4-fluorophenyl)methylsulfanylmethyl]cyclopropyl]acetate (PubChem CID 114000181) has the molecular formula C14H16ClFO2S and a molecular weight of 302.80 g/mol. Its IUPAC name is methyl 2-[1-[(3-chloro-4-fluorophenyl)methylsulfanylmethyl]cyclopropyl]acetate.
| Compound Name | methyl 2-[1-[(3-chloro-4-fluorophenyl)methylsulfanylmethyl]cyclopropyl]acetate |
|---|---|
| PubChem CID | 114000181 |
| Molecular Formula | C14H16ClFO2S |
| Molecular Weight | 302.80 g/mol |
| Exact Mass | 302.05 |
| IUPAC Name | methyl 2-[1-[(3-chloro-4-fluorophenyl)methylsulfanylmethyl]cyclopropyl]acetate |
| SMILES | COC(=O)CC1(CSCc2ccc(F)c(Cl)c2)CC1 |
| InChI | InChI=1S/C14H16ClFO2S/c1-18-13(17)7-14(4-5-14)9-19-8-10-2-3-12(16)11(15)6-10/h2-3,6H,4-5,7-9H2,1H3 |
| InChIKey | HDPHTYWXHYVMII-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.80 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |