C13H18O3S — CID 107775939
methyl 2-[1-[(5-methylfuran-2-yl)methylsulfanylmethyl]cyclopropyl]acetate (PubChem CID 107775939) has the molecular formula C13H18O3S and a molecular weight of 254.35 g/mol. Its IUPAC name is methyl 2-[1-[(5-methylfuran-2-yl)methylsulfanylmethyl]cyclopropyl]acetate.
| Compound Name | methyl 2-[1-[(5-methylfuran-2-yl)methylsulfanylmethyl]cyclopropyl]acetate |
|---|---|
| PubChem CID | 107775939 |
| Molecular Formula | C13H18O3S |
| Molecular Weight | 254.35 g/mol |
| Exact Mass | 254.10 |
| IUPAC Name | methyl 2-[1-[(5-methylfuran-2-yl)methylsulfanylmethyl]cyclopropyl]acetate |
| SMILES | COC(=O)CC1(CSCc2ccc(C)o2)CC1 |
| InChI | InChI=1S/C13H18O3S/c1-10-3-4-11(16-10)8-17-9-13(5-6-13)7-12(14)15-2/h3-4H,5-9H2,1-2H3 |
| InChIKey | ORMHLWDHMLPAEJ-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 39.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.35 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |