C14H17BrO3S — CID 65442319
2-[1-[(3-bromo-4-methoxyphenyl)methylsulfanylmethyl]cyclopropyl]acetic acid (PubChem CID 65442319) has the molecular formula C14H17BrO3S and a molecular weight of 345.26 g/mol. Its IUPAC name is 2-[1-[(3-bromo-4-methoxyphenyl)methylsulfanylmethyl]cyclopropyl]acetic acid.
| Compound Name | 2-[1-[(3-bromo-4-methoxyphenyl)methylsulfanylmethyl]cyclopropyl]acetic acid |
|---|---|
| PubChem CID | 65442319 |
| Molecular Formula | C14H17BrO3S |
| Molecular Weight | 345.26 g/mol |
| Exact Mass | 344.01 |
| IUPAC Name | 2-[1-[(3-bromo-4-methoxyphenyl)methylsulfanylmethyl]cyclopropyl]acetic acid |
| SMILES | COc1ccc(CSCC2(CC(=O)O)CC2)cc1Br |
| InChI | InChI=1S/C14H17BrO3S/c1-18-12-3-2-10(6-11(12)15)8-19-9-14(4-5-14)7-13(16)17/h2-3,6H,4-5,7-9H2,1H3,(H,16,17) |
| InChIKey | HWQPDNJAXUAFFG-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.26 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |