C11H13BrO2S2 — CID 65443494
2-[1-[(4-bromothiophen-2-yl)methylsulfanylmethyl]cyclopropyl]acetic acid (PubChem CID 65443494) has the molecular formula C11H13BrO2S2 and a molecular weight of 321.26 g/mol. Its IUPAC name is 2-[1-[(4-bromothiophen-2-yl)methylsulfanylmethyl]cyclopropyl]acetic acid.
| Compound Name | 2-[1-[(4-bromothiophen-2-yl)methylsulfanylmethyl]cyclopropyl]acetic acid |
|---|---|
| PubChem CID | 65443494 |
| Molecular Formula | C11H13BrO2S2 |
| Molecular Weight | 321.26 g/mol |
| Exact Mass | 319.95 |
| IUPAC Name | 2-[1-[(4-bromothiophen-2-yl)methylsulfanylmethyl]cyclopropyl]acetic acid |
| SMILES | O=C(O)CC1(CSCc2cc(Br)cs2)CC1 |
| InChI | InChI=1S/C11H13BrO2S2/c12-8-3-9(16-5-8)6-15-7-11(1-2-11)4-10(13)14/h3,5H,1-2,4,6-7H2,(H,13,14) |
| InChIKey | OEEPZLIWTBLUIO-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.26 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |