C11H12BrFO — CID 66024777
[1-[(3-bromo-4-fluorophenyl)methyl]cyclopropyl]methanol (PubChem CID 66024777) has the molecular formula C11H12BrFO and a molecular weight of 259.12 g/mol. Its IUPAC name is [1-[(3-bromo-4-fluorophenyl)methyl]cyclopropyl]methanol.
| Compound Name | [1-[(3-bromo-4-fluorophenyl)methyl]cyclopropyl]methanol |
|---|---|
| PubChem CID | 66024777 |
| Molecular Formula | C11H12BrFO |
| Molecular Weight | 259.12 g/mol |
| Exact Mass | 258.01 |
| IUPAC Name | [1-[(3-bromo-4-fluorophenyl)methyl]cyclopropyl]methanol |
| SMILES | OCC1(Cc2ccc(F)c(Br)c2)CC1 |
| InChI | InChI=1S/C11H12BrFO/c12-9-5-8(1-2-10(9)13)6-11(7-14)3-4-11/h1-2,5,14H,3-4,6-7H2 |
| InChIKey | VOZZSQMYGYWBOW-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.12 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |