C13H16ClFO — CID 107894887
[1-[(4-chloro-3-fluorophenyl)methyl]cyclopentyl]methanol (PubChem CID 107894887) has the molecular formula C13H16ClFO and a molecular weight of 242.72 g/mol. Its IUPAC name is [1-[(4-chloro-3-fluorophenyl)methyl]cyclopentyl]methanol.
| Compound Name | [1-[(4-chloro-3-fluorophenyl)methyl]cyclopentyl]methanol |
|---|---|
| PubChem CID | 107894887 |
| Molecular Formula | C13H16ClFO |
| Molecular Weight | 242.72 g/mol |
| Exact Mass | 242.09 |
| IUPAC Name | [1-[(4-chloro-3-fluorophenyl)methyl]cyclopentyl]methanol |
| SMILES | OCC1(Cc2ccc(Cl)c(F)c2)CCCC1 |
| InChI | InChI=1S/C13H16ClFO/c14-11-4-3-10(7-12(11)15)8-13(9-16)5-1-2-6-13/h3-4,7,16H,1-2,5-6,8-9H2 |
| InChIKey | NEJILQZVMLTBKG-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.72 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |