C10H10BrFO2S — CID 43385171
3-[(4-bromo-2-fluorophenyl)methylsulfanyl]propanoic acid (PubChem CID 43385171) has the molecular formula C10H10BrFO2S and a molecular weight of 293.16 g/mol. Its IUPAC name is 3-[(4-bromo-2-fluorophenyl)methylsulfanyl]propanoic acid.
| Compound Name | 3-[(4-bromo-2-fluorophenyl)methylsulfanyl]propanoic acid |
|---|---|
| PubChem CID | 43385171 |
| Molecular Formula | C10H10BrFO2S |
| Molecular Weight | 293.16 g/mol |
| Exact Mass | 291.96 |
| IUPAC Name | 3-[(4-bromo-2-fluorophenyl)methylsulfanyl]propanoic acid |
| SMILES | O=C(O)CCSCc1ccc(Br)cc1F |
| InChI | InChI=1S/C10H10BrFO2S/c11-8-2-1-7(9(12)5-8)6-15-4-3-10(13)14/h1-2,5H,3-4,6H2,(H,13,14) |
| InChIKey | SNLTWPIZTFXCTE-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.16 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|