C11H13FO2S — CID 105369880
3-[(5-fluoro-2-methylphenyl)methylsulfanyl]propanoic acid (PubChem CID 105369880) has the molecular formula C11H13FO2S and a molecular weight of 228.29 g/mol. Its IUPAC name is 3-[(5-fluoro-2-methylphenyl)methylsulfanyl]propanoic acid.
| Compound Name | 3-[(5-fluoro-2-methylphenyl)methylsulfanyl]propanoic acid |
|---|---|
| PubChem CID | 105369880 |
| Molecular Formula | C11H13FO2S |
| Molecular Weight | 228.29 g/mol |
| Exact Mass | 228.06 |
| IUPAC Name | 3-[(5-fluoro-2-methylphenyl)methylsulfanyl]propanoic acid |
| SMILES | Cc1ccc(F)cc1CSCCC(=O)O |
| InChI | InChI=1S/C11H13FO2S/c1-8-2-3-10(12)6-9(8)7-15-5-4-11(13)14/h2-3,6H,4-5,7H2,1H3,(H,13,14) |
| InChIKey | GKEQRZPVMDXZDZ-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.29 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|