C24H21ClF3NO2S2 — CID 142014124
3-[[2-[1-(N-(4-chlorophenyl)sulfanyl-2,5-difluoroanilino)ethyl]-5-fluorophenyl]methylsulfanyl]propanoic acid (PubChem CID 142014124) has the molecular formula C24H21ClF3NO2S2 and a molecular weight of 512.02 g/mol. Its IUPAC name is 3-[[2-[1-(N-(4-chlorophenyl)sulfanyl-2,5-difluoroanilino)ethyl]-5-fluorophenyl]methylsulfanyl]propanoic acid.
| Compound Name | 3-[[2-[1-(N-(4-chlorophenyl)sulfanyl-2,5-difluoroanilino)ethyl]-5-fluorophenyl]methylsulfanyl]propanoic acid |
|---|---|
| PubChem CID | 142014124 |
| Molecular Formula | C24H21ClF3NO2S2 |
| Molecular Weight | 512.02 g/mol |
| Exact Mass | 511.07 |
| IUPAC Name | 3-[[2-[1-(N-(4-chlorophenyl)sulfanyl-2,5-difluoroanilino)ethyl]-5-fluorophenyl]methylsulfanyl]propanoic acid |
| SMILES | CC(c1ccc(F)cc1CSCCC(=O)O)N(Sc1ccc(Cl)cc1)c1cc(F)ccc1F |
| InChI | InChI=1S/C24H21ClF3NO2S2/c1-15(21-8-4-18(26)12-16(21)14-32-11-10-24(30)31)29(23-13-19(27)5-9-22(23)28)33-20-6-2-17(25)3-7-20/h2-9,12-13,15H,10-11,14H2,1H3,(H,30,31) |
| InChIKey | XCUYSQWUWBORBQ-UHFFFAOYSA-N |
| XLogP | 7.74 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.02 |
| LogP ≤ 5 | 7.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|