C13H15BrFNOS — CID 113218288
2-[(4-bromo-2-fluorophenyl)methylsulfanyl]-1-pyrrolidin-1-ylethanone (PubChem CID 113218288) has the molecular formula C13H15BrFNOS and a molecular weight of 332.24 g/mol. Its IUPAC name is 2-[(4-bromo-2-fluorophenyl)methylsulfanyl]-1-pyrrolidin-1-ylethanone.
| Compound Name | 2-[(4-bromo-2-fluorophenyl)methylsulfanyl]-1-pyrrolidin-1-ylethanone |
|---|---|
| PubChem CID | 113218288 |
| Molecular Formula | C13H15BrFNOS |
| Molecular Weight | 332.24 g/mol |
| Exact Mass | 331.00 |
| IUPAC Name | 2-[(4-bromo-2-fluorophenyl)methylsulfanyl]-1-pyrrolidin-1-ylethanone |
| SMILES | O=C(CSCc1ccc(Br)cc1F)N1CCCC1 |
| InChI | InChI=1S/C13H15BrFNOS/c14-11-4-3-10(12(15)7-11)8-18-9-13(17)16-5-1-2-6-16/h3-4,7H,1-2,5-6,8-9H2 |
| InChIKey | KUPRSHHHIZKHJB-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.24 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |