C19H20ClFN2OS — CID 100520841
2-[(4-chloro-2-fluorophenyl)methylsulfanyl]-1-(4-phenylpiperazin-1-yl)ethanone (PubChem CID 100520841) has the molecular formula C19H20ClFN2OS and a molecular weight of 378.90 g/mol. Its IUPAC name is 2-[(4-chloro-2-fluorophenyl)methylsulfanyl]-1-(4-phenylpiperazin-1-yl)ethanone.
| Compound Name | 2-[(4-chloro-2-fluorophenyl)methylsulfanyl]-1-(4-phenylpiperazin-1-yl)ethanone |
|---|---|
| PubChem CID | 100520841 |
| Molecular Formula | C19H20ClFN2OS |
| Molecular Weight | 378.90 g/mol |
| Exact Mass | 378.10 |
| IUPAC Name | 2-[(4-chloro-2-fluorophenyl)methylsulfanyl]-1-(4-phenylpiperazin-1-yl)ethanone |
| SMILES | O=C(CSCc1ccc(Cl)cc1F)N1CCN(c2ccccc2)CC1 |
| InChI | InChI=1S/C19H20ClFN2OS/c20-16-7-6-15(18(21)12-16)13-25-14-19(24)23-10-8-22(9-11-23)17-4-2-1-3-5-17/h1-7,12H,8-11,13-14H2 |
| InChIKey | ZILSMRFESJDHOY-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.90 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |