C16H22ClNO3 — CID 94966413
6-[4-(4-chlorophenyl)butanoylamino]hexanoic acid (PubChem CID 94966413) has the molecular formula C16H22ClNO3 and a molecular weight of 311.81 g/mol. Its IUPAC name is 6-[4-(4-chlorophenyl)butanoylamino]hexanoic acid.
| Compound Name | 6-[4-(4-chlorophenyl)butanoylamino]hexanoic acid |
|---|---|
| PubChem CID | 94966413 |
| Molecular Formula | C16H22ClNO3 |
| Molecular Weight | 311.81 g/mol |
| Exact Mass | 311.13 |
| IUPAC Name | 6-[4-(4-chlorophenyl)butanoylamino]hexanoic acid |
| SMILES | O=C(O)CCCCCNC(=O)CCCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C16H22ClNO3/c17-14-10-8-13(9-11-14)5-4-6-15(19)18-12-3-1-2-7-16(20)21/h8-11H,1-7,12H2,(H,18,19)(H,20,21) |
| InChIKey | LZEQLDFNZUPCGQ-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.81 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|