C19H28ClNO3 — CID 170776958
6-[4-(4-chlorophenyl)butanoylamino]-2-propan-2-ylhexanoic acid (PubChem CID 170776958) has the molecular formula C19H28ClNO3 and a molecular weight of 353.89 g/mol. Its IUPAC name is 6-[4-(4-chlorophenyl)butanoylamino]-2-propan-2-ylhexanoic acid.
| Compound Name | 6-[4-(4-chlorophenyl)butanoylamino]-2-propan-2-ylhexanoic acid |
|---|---|
| PubChem CID | 170776958 |
| Molecular Formula | C19H28ClNO3 |
| Molecular Weight | 353.89 g/mol |
| Exact Mass | 353.18 |
| IUPAC Name | 6-[4-(4-chlorophenyl)butanoylamino]-2-propan-2-ylhexanoic acid |
| SMILES | CC(C)C(CCCCNC(=O)CCCc1ccc(Cl)cc1)C(=O)O |
| InChI | InChI=1S/C19H28ClNO3/c1-14(2)17(19(23)24)7-3-4-13-21-18(22)8-5-6-15-9-11-16(20)12-10-15/h9-12,14,17H,3-8,13H2,1-2H3,(H,21,22)(H,23,24) |
| InChIKey | BHRJEYAINUGEPK-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.89 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|