C17H24ClNO3 — CID 119252864
2-[[4-(4-chlorophenyl)butanoylamino]methyl]-4-methylpentanoic acid (PubChem CID 119252864) has the molecular formula C17H24ClNO3 and a molecular weight of 325.84 g/mol. Its IUPAC name is 2-[[4-(4-chlorophenyl)butanoylamino]methyl]-4-methylpentanoic acid.
| Compound Name | 2-[[4-(4-chlorophenyl)butanoylamino]methyl]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 119252864 |
| Molecular Formula | C17H24ClNO3 |
| Molecular Weight | 325.84 g/mol |
| Exact Mass | 325.14 |
| IUPAC Name | 2-[[4-(4-chlorophenyl)butanoylamino]methyl]-4-methylpentanoic acid |
| SMILES | CC(C)CC(CNC(=O)CCCc1ccc(Cl)cc1)C(=O)O |
| InChI | InChI=1S/C17H24ClNO3/c1-12(2)10-14(17(21)22)11-19-16(20)5-3-4-13-6-8-15(18)9-7-13/h6-9,12,14H,3-5,10-11H2,1-2H3,(H,19,20)(H,21,22) |
| InChIKey | QNGKZFMTCXGMPW-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.84 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |