C19H29IN2O3 — CID 177080541
6-[4-(4-iodophenyl)butanoylamino]-2-(propan-2-ylamino)hexanoic acid (PubChem CID 177080541) has the molecular formula C19H29IN2O3 and a molecular weight of 460.36 g/mol. Its IUPAC name is 6-[4-(4-iodophenyl)butanoylamino]-2-(propan-2-ylamino)hexanoic acid.
| Compound Name | 6-[4-(4-iodophenyl)butanoylamino]-2-(propan-2-ylamino)hexanoic acid |
|---|---|
| PubChem CID | 177080541 |
| Molecular Formula | C19H29IN2O3 |
| Molecular Weight | 460.36 g/mol |
| Exact Mass | 460.12 |
| IUPAC Name | 6-[4-(4-iodophenyl)butanoylamino]-2-(propan-2-ylamino)hexanoic acid |
| SMILES | CC(C)NC(CCCCNC(=O)CCCc1ccc(I)cc1)C(=O)O |
| InChI | InChI=1S/C19H29IN2O3/c1-14(2)22-17(19(24)25)7-3-4-13-21-18(23)8-5-6-15-9-11-16(20)12-10-15/h9-12,14,17,22H,3-8,13H2,1-2H3,(H,21,23)(H,24,25) |
| InChIKey | UTXLUPAARCPSQP-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.36 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|