C24H37Cl2N3O5 — CID 58078462
2-[4-[4-[bis(2-chloroethyl)amino]phenyl]butanoylamino]-6-(3-methoxypropanoylamino)hexanoic acid (PubChem CID 58078462) has the molecular formula C24H37Cl2N3O5 and a molecular weight of 518.48 g/mol. Its IUPAC name is 2-[4-[4-[bis(2-chloroethyl)amino]phenyl]butanoylamino]-6-(3-methoxypropanoylamino)hexanoic acid.
| Compound Name | 2-[4-[4-[bis(2-chloroethyl)amino]phenyl]butanoylamino]-6-(3-methoxypropanoylamino)hexanoic acid |
|---|---|
| PubChem CID | 58078462 |
| Molecular Formula | C24H37Cl2N3O5 |
| Molecular Weight | 518.48 g/mol |
| Exact Mass | 517.21 |
| IUPAC Name | 2-[4-[4-[bis(2-chloroethyl)amino]phenyl]butanoylamino]-6-(3-methoxypropanoylamino)hexanoic acid |
| SMILES | COCCC(=O)NCCCCC(NC(=O)CCCc1ccc(N(CCCl)CCCl)cc1)C(=O)O |
| InChI | InChI=1S/C24H37Cl2N3O5/c1-34-18-12-22(30)27-15-3-2-6-21(24(32)33)28-23(31)7-4-5-19-8-10-20(11-9-19)29(16-13-25)17-14-26/h8-11,21H,2-7,12-18H2,1H3,(H,27,30)(H,28,31)(H,32,33) |
| InChIKey | HNAAGMJYMDNHGB-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 107.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.48 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|