C20H33Cl2N3O9P2 — CID 19388860
[4-[[2-[4-[4-[bis(2-chloroethyl)amino]phenyl]butanoylamino]acetyl]amino]-1-hydroxy-1-phosphonobutyl]phosphonic acid (PubChem CID 19388860) has the molecular formula C20H33Cl2N3O9P2 and a molecular weight of 592.35 g/mol. Its IUPAC name is [4-[[2-[4-[4-[bis(2-chloroethyl)amino]phenyl]butanoylamino]acetyl]amino]-1-hydroxy-1-phosphonobutyl]phosphonic acid.
| Compound Name | [4-[[2-[4-[4-[bis(2-chloroethyl)amino]phenyl]butanoylamino]acetyl]amino]-1-hydroxy-1-phosphonobutyl]phosphonic acid |
|---|---|
| PubChem CID | 19388860 |
| Molecular Formula | C20H33Cl2N3O9P2 |
| Molecular Weight | 592.35 g/mol |
| Exact Mass | 591.11 |
| IUPAC Name | [4-[[2-[4-[4-[bis(2-chloroethyl)amino]phenyl]butanoylamino]acetyl]amino]-1-hydroxy-1-phosphonobutyl]phosphonic acid |
| SMILES | O=C(CCCc1ccc(N(CCCl)CCCl)cc1)NCC(=O)NCCCC(O)(P(=O)(O)O)P(=O)(O)O |
| InChI | InChI=1S/C20H33Cl2N3O9P2/c21-10-13-25(14-11-22)17-7-5-16(6-8-17)3-1-4-18(26)24-15-19(27)23-12-2-9-20(28,35(29,30)31)36(32,33)34/h5-8,28H,1-4,9-15H2,(H,23,27)(H,24,26)(H2,29,30,31)(H2,32,33,34) |
| InChIKey | RLNPRSGIBRCYSI-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 196.73 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.35 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|