C21H35Cl2N3O9P2 — CID 19388864
[5-[[2-[4-[4-[bis(2-chloroethyl)amino]phenyl]butanoylamino]acetyl]amino]-1-hydroxy-1-phosphonopentyl]phosphonic acid (PubChem CID 19388864) has the molecular formula C21H35Cl2N3O9P2 and a molecular weight of 606.38 g/mol. Its IUPAC name is [5-[[2-[4-[4-[bis(2-chloroethyl)amino]phenyl]butanoylamino]acetyl]amino]-1-hydroxy-1-phosphonopentyl]phosphonic acid.
| Compound Name | [5-[[2-[4-[4-[bis(2-chloroethyl)amino]phenyl]butanoylamino]acetyl]amino]-1-hydroxy-1-phosphonopentyl]phosphonic acid |
|---|---|
| PubChem CID | 19388864 |
| Molecular Formula | C21H35Cl2N3O9P2 |
| Molecular Weight | 606.38 g/mol |
| Exact Mass | 605.12 |
| IUPAC Name | [5-[[2-[4-[4-[bis(2-chloroethyl)amino]phenyl]butanoylamino]acetyl]amino]-1-hydroxy-1-phosphonopentyl]phosphonic acid |
| SMILES | O=C(CCCc1ccc(N(CCCl)CCCl)cc1)NCC(=O)NCCCCC(O)(P(=O)(O)O)P(=O)(O)O |
| InChI | InChI=1S/C21H35Cl2N3O9P2/c22-11-14-26(15-12-23)18-8-6-17(7-9-18)4-3-5-19(27)25-16-20(28)24-13-2-1-10-21(29,36(30,31)32)37(33,34)35/h6-9,29H,1-5,10-16H2,(H,24,28)(H,25,27)(H2,30,31,32)(H2,33,34,35) |
| InChIKey | OSIYZKDVXKUPDZ-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 196.73 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.38 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|