C47H58Cl4N6O4 — CID 11958333
3-[4-[4-[bis(2-chloroethyl)amino]phenyl]butanoylamino]-N-[5-[[3-[4-[4-[bis(2-chloroethyl)amino]phenyl]butanoylamino]benzoyl]amino]pentyl]benzamide (PubChem CID 11958333) has the molecular formula C47H58Cl4N6O4 and a molecular weight of 912.83 g/mol. Its IUPAC name is 3-[4-[4-[bis(2-chloroethyl)amino]phenyl]butanoylamino]-N-[5-[[3-[4-[4-[bis(2-chloroethyl)amino]phenyl]butanoylamino]benzoyl]amino]pentyl]benzamide.
| Compound Name | 3-[4-[4-[bis(2-chloroethyl)amino]phenyl]butanoylamino]-N-[5-[[3-[4-[4-[bis(2-chloroethyl)amino]phenyl]butanoylamino]benzoyl]amino]pentyl]benzamide |
|---|---|
| PubChem CID | 11958333 |
| Molecular Formula | C47H58Cl4N6O4 |
| Molecular Weight | 912.83 g/mol |
| Exact Mass | 910.33 |
| IUPAC Name | 3-[4-[4-[bis(2-chloroethyl)amino]phenyl]butanoylamino]-N-[5-[[3-[4-[4-[bis(2-chloroethyl)amino]phenyl]butanoylamino]benzoyl]amino]pentyl]benzamide |
| SMILES | O=C(CCCc1ccc(N(CCCl)CCCl)cc1)Nc1cccc(C(=O)NCCCCCNC(=O)c2cccc(NC(=O)CCCc3ccc(N(CCCl)CCCl)cc3)c2)c1 |
| InChI | InChI=1S/C47H58Cl4N6O4/c48-24-30-56(31-25-49)42-20-16-36(17-21-42)8-4-14-44(58)54-40-12-6-10-38(34-40)46(60)52-28-2-1-3-29-53-47(61)39-11-7-13-41(35-39)55-45(59)15-5-9-37-18-22-43(23-19-37)57(32-26-50)33-27-51/h6-7,10-13,16-23,34-35H,1-5,8-9,14-15,24-33H2,(H,52,60)(H,53,61)(H,54,58)(H,55,59) |
| InChIKey | FVFSBIAJOVPVSO-UHFFFAOYSA-N |
| XLogP | 9.51 |
| TPSA | 122.88 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 912.83 |
| LogP ≤ 5 | 9.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|