C29H36Cl3N9O2 — CID 70100934
N-[3-[4-[bis(2-chloroethyl)amino]phenyl]propyl]-2-[4-[[2-(diaminomethylideneamino)acetyl]amino]-1-methylpyrrol-2-yl]-3H-benzimidazole-5-carboxamide;hydrochloride (PubChem CID 70100934) has the molecular formula C29H36Cl3N9O2 and a molecular weight of 649.03 g/mol. Its IUPAC name is N-[3-[4-[bis(2-chloroethyl)amino]phenyl]propyl]-2-[4-[[2-(diaminomethylideneamino)acetyl]amino]-1-methylpyrrol-2-yl]-3H-benzimidazole-5-carboxamide;hydrochloride.
| Compound Name | N-[3-[4-[bis(2-chloroethyl)amino]phenyl]propyl]-2-[4-[[2-(diaminomethylideneamino)acetyl]amino]-1-methylpyrrol-2-yl]-3H-benzimidazole-5-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 70100934 |
| Molecular Formula | C29H36Cl3N9O2 |
| Molecular Weight | 649.03 g/mol |
| Exact Mass | 647.21 |
| IUPAC Name | N-[3-[4-[bis(2-chloroethyl)amino]phenyl]propyl]-2-[4-[[2-(diaminomethylideneamino)acetyl]amino]-1-methylpyrrol-2-yl]-3H-benzimidazole-5-carboxamide;hydrochloride |
| SMILES | Cl.Cn1cc(NC(=O)CN=C(N)N)cc1-c1nc2ccc(C(=O)NCCCc3ccc(N(CCCl)CCCl)cc3)cc2[nH]1 |
| InChI | InChI=1S/C29H35Cl2N9O2.ClH/c1-39-18-21(36-26(41)17-35-29(32)33)16-25(39)27-37-23-9-6-20(15-24(23)38-27)28(42)34-12-2-3-19-4-7-22(8-5-19)40(13-10-30)14-11-31;/h4-9,15-16,18H,2-3,10-14,17H2,1H3,(H,34,42)(H,36,41)(H,37,38)(H4,32,33,35);1H |
| InChIKey | ZHODULSKROPPQT-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 159.45 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 649.03 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|