C28H31Cl2N7O3 — CID 70102125
N-[5-[6-[[4-[bis(2-chloroethyl)amino]phenyl]carbamoyl]-1H-benzimidazol-2-yl]-1-methylpyrrol-3-yl]morpholine-4-carboxamide (PubChem CID 70102125) has the molecular formula C28H31Cl2N7O3 and a molecular weight of 584.51 g/mol. Its IUPAC name is N-[5-[6-[[4-[bis(2-chloroethyl)amino]phenyl]carbamoyl]-1H-benzimidazol-2-yl]-1-methylpyrrol-3-yl]morpholine-4-carboxamide.
| Compound Name | N-[5-[6-[[4-[bis(2-chloroethyl)amino]phenyl]carbamoyl]-1H-benzimidazol-2-yl]-1-methylpyrrol-3-yl]morpholine-4-carboxamide |
|---|---|
| PubChem CID | 70102125 |
| Molecular Formula | C28H31Cl2N7O3 |
| Molecular Weight | 584.51 g/mol |
| Exact Mass | 583.19 |
| IUPAC Name | N-[5-[6-[[4-[bis(2-chloroethyl)amino]phenyl]carbamoyl]-1H-benzimidazol-2-yl]-1-methylpyrrol-3-yl]morpholine-4-carboxamide |
| SMILES | Cn1cc(NC(=O)N2CCOCC2)cc1-c1nc2ccc(C(=O)Nc3ccc(N(CCCl)CCCl)cc3)cc2[nH]1 |
| InChI | InChI=1S/C28H31Cl2N7O3/c1-35-18-21(32-28(39)37-12-14-40-15-13-37)17-25(35)26-33-23-7-2-19(16-24(23)34-26)27(38)31-20-3-5-22(6-4-20)36(10-8-29)11-9-30/h2-7,16-18H,8-15H2,1H3,(H,31,38)(H,32,39)(H,33,34) |
| InChIKey | SWRVLORGHLRGIK-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 107.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.51 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|