C26H30N4O3 — CID 169320058
7-(diethylamino)-N-[4-(1,4-oxazepane-4-carbonyl)phenyl]quinoline-3-carboxamide (PubChem CID 169320058) has the molecular formula C26H30N4O3 and a molecular weight of 446.55 g/mol. Its IUPAC name is 7-(diethylamino)-N-[4-(1,4-oxazepane-4-carbonyl)phenyl]quinoline-3-carboxamide.
| Compound Name | 7-(diethylamino)-N-[4-(1,4-oxazepane-4-carbonyl)phenyl]quinoline-3-carboxamide |
|---|---|
| PubChem CID | 169320058 |
| Molecular Formula | C26H30N4O3 |
| Molecular Weight | 446.55 g/mol |
| Exact Mass | 446.23 |
| IUPAC Name | 7-(diethylamino)-N-[4-(1,4-oxazepane-4-carbonyl)phenyl]quinoline-3-carboxamide |
| SMILES | CCN(CC)c1ccc2cc(C(=O)Nc3ccc(C(=O)N4CCCOCC4)cc3)cnc2c1 |
| InChI | InChI=1S/C26H30N4O3/c1-3-29(4-2)23-11-8-20-16-21(18-27-24(20)17-23)25(31)28-22-9-6-19(7-10-22)26(32)30-12-5-14-33-15-13-30/h6-11,16-18H,3-5,12-15H2,1-2H3,(H,28,31) |
| InChIKey | YVGMYJABEBQZTO-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 74.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.55 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |