C26H27F2N3O5 — CID 172574387
7-[bis(2-fluoroethyl)amino]-N-[4-(1,4-oxazepane-4-carbonyl)phenyl]-2-oxochromene-3-carboxamide (PubChem CID 172574387) has the molecular formula C26H27F2N3O5 and a molecular weight of 499.51 g/mol. Its IUPAC name is 7-[bis(2-fluoroethyl)amino]-N-[4-(1,4-oxazepane-4-carbonyl)phenyl]-2-oxochromene-3-carboxamide.
| Compound Name | 7-[bis(2-fluoroethyl)amino]-N-[4-(1,4-oxazepane-4-carbonyl)phenyl]-2-oxochromene-3-carboxamide |
|---|---|
| PubChem CID | 172574387 |
| Molecular Formula | C26H27F2N3O5 |
| Molecular Weight | 499.51 g/mol |
| Exact Mass | 499.19 |
| IUPAC Name | 7-[bis(2-fluoroethyl)amino]-N-[4-(1,4-oxazepane-4-carbonyl)phenyl]-2-oxochromene-3-carboxamide |
| SMILES | O=C(Nc1ccc(C(=O)N2CCCOCC2)cc1)c1cc2ccc(N(CCF)CCF)cc2oc1=O |
| InChI | InChI=1S/C26H27F2N3O5/c27-8-11-30(12-9-28)21-7-4-19-16-22(26(34)36-23(19)17-21)24(32)29-20-5-2-18(3-6-20)25(33)31-10-1-14-35-15-13-31/h2-7,16-17H,1,8-15H2,(H,29,32) |
| InChIKey | OBRVQEMPILXKDN-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 92.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.51 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|