C25H27N3O6 — CID 172574365
6-(2-methoxyethoxy)-N-[4-(1,4-oxazepane-4-carbonyl)phenyl]-2-oxo-1H-quinoline-3-carboxamide (PubChem CID 172574365) has the molecular formula C25H27N3O6 and a molecular weight of 465.51 g/mol. Its IUPAC name is 6-(2-methoxyethoxy)-N-[4-(1,4-oxazepane-4-carbonyl)phenyl]-2-oxo-1H-quinoline-3-carboxamide.
| Compound Name | 6-(2-methoxyethoxy)-N-[4-(1,4-oxazepane-4-carbonyl)phenyl]-2-oxo-1H-quinoline-3-carboxamide |
|---|---|
| PubChem CID | 172574365 |
| Molecular Formula | C25H27N3O6 |
| Molecular Weight | 465.51 g/mol |
| Exact Mass | 465.19 |
| IUPAC Name | 6-(2-methoxyethoxy)-N-[4-(1,4-oxazepane-4-carbonyl)phenyl]-2-oxo-1H-quinoline-3-carboxamide |
| SMILES | COCCOc1ccc2[nH]c(=O)c(C(=O)Nc3ccc(C(=O)N4CCCOCC4)cc3)cc2c1 |
| InChI | InChI=1S/C25H27N3O6/c1-32-13-14-34-20-7-8-22-18(15-20)16-21(24(30)27-22)23(29)26-19-5-3-17(4-6-19)25(31)28-9-2-11-33-12-10-28/h3-8,15-16H,2,9-14H2,1H3,(H,26,29)(H,27,30) |
| InChIKey | AAXCMBAATTVQKF-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 109.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.51 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|