C18H24N2O6 — CID 17194785
2-methoxyethyl 4-[4-(morpholine-4-carbonyl)anilino]-4-oxobutanoate (PubChem CID 17194785) has the molecular formula C18H24N2O6 and a molecular weight of 364.40 g/mol. Its IUPAC name is 2-methoxyethyl 4-[4-(morpholine-4-carbonyl)anilino]-4-oxobutanoate.
| Compound Name | 2-methoxyethyl 4-[4-(morpholine-4-carbonyl)anilino]-4-oxobutanoate |
|---|---|
| PubChem CID | 17194785 |
| Molecular Formula | C18H24N2O6 |
| Molecular Weight | 364.40 g/mol |
| Exact Mass | 364.16 |
| IUPAC Name | 2-methoxyethyl 4-[4-(morpholine-4-carbonyl)anilino]-4-oxobutanoate |
| SMILES | COCCOC(=O)CCC(=O)Nc1ccc(C(=O)N2CCOCC2)cc1 |
| InChI | InChI=1S/C18H24N2O6/c1-24-12-13-26-17(22)7-6-16(21)19-15-4-2-14(3-5-15)18(23)20-8-10-25-11-9-20/h2-5H,6-13H2,1H3,(H,19,21) |
| InChIKey | YLEJJWAZHQSQOE-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.40 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|