C20H28N2O5 — CID 17199104
2-methoxyethyl 4-[4-(azepane-1-carbonyl)anilino]-4-oxobutanoate (PubChem CID 17199104) has the molecular formula C20H28N2O5 and a molecular weight of 376.45 g/mol. Its IUPAC name is 2-methoxyethyl 4-[4-(azepane-1-carbonyl)anilino]-4-oxobutanoate.
| Compound Name | 2-methoxyethyl 4-[4-(azepane-1-carbonyl)anilino]-4-oxobutanoate |
|---|---|
| PubChem CID | 17199104 |
| Molecular Formula | C20H28N2O5 |
| Molecular Weight | 376.45 g/mol |
| Exact Mass | 376.20 |
| IUPAC Name | 2-methoxyethyl 4-[4-(azepane-1-carbonyl)anilino]-4-oxobutanoate |
| SMILES | COCCOC(=O)CCC(=O)Nc1ccc(C(=O)N2CCCCCC2)cc1 |
| InChI | InChI=1S/C20H28N2O5/c1-26-14-15-27-19(24)11-10-18(23)21-17-8-6-16(7-9-17)20(25)22-12-4-2-3-5-13-22/h6-9H,2-5,10-15H2,1H3,(H,21,23) |
| InChIKey | BZRNCBARTZOVMT-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.45 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|