C18H25NO6 — CID 17339145
2-methoxyethyl 4-oxo-4-[4-(oxolan-2-ylmethoxy)anilino]butanoate (PubChem CID 17339145) has the molecular formula C18H25NO6 and a molecular weight of 351.40 g/mol. Its IUPAC name is 2-methoxyethyl 4-oxo-4-[4-(oxolan-2-ylmethoxy)anilino]butanoate.
| Compound Name | 2-methoxyethyl 4-oxo-4-[4-(oxolan-2-ylmethoxy)anilino]butanoate |
|---|---|
| PubChem CID | 17339145 |
| Molecular Formula | C18H25NO6 |
| Molecular Weight | 351.40 g/mol |
| Exact Mass | 351.17 |
| IUPAC Name | 2-methoxyethyl 4-oxo-4-[4-(oxolan-2-ylmethoxy)anilino]butanoate |
| SMILES | COCCOC(=O)CCC(=O)Nc1ccc(OCC2CCCO2)cc1 |
| InChI | InChI=1S/C18H25NO6/c1-22-11-12-24-18(21)9-8-17(20)19-14-4-6-15(7-5-14)25-13-16-3-2-10-23-16/h4-7,16H,2-3,8-13H2,1H3,(H,19,20) |
| InChIKey | IEGWHCAVXHAFSH-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.40 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|