C18H24N2O5S — CID 4958052
ethyl 4-oxo-4-[[4-(oxolan-2-ylmethoxy)phenyl]carbamothioylamino]butanoate (PubChem CID 4958052) has the molecular formula C18H24N2O5S and a molecular weight of 380.47 g/mol. Its IUPAC name is ethyl 4-oxo-4-[[4-(oxolan-2-ylmethoxy)phenyl]carbamothioylamino]butanoate.
| Compound Name | ethyl 4-oxo-4-[[4-(oxolan-2-ylmethoxy)phenyl]carbamothioylamino]butanoate |
|---|---|
| PubChem CID | 4958052 |
| Molecular Formula | C18H24N2O5S |
| Molecular Weight | 380.47 g/mol |
| Exact Mass | 380.14 |
| IUPAC Name | ethyl 4-oxo-4-[[4-(oxolan-2-ylmethoxy)phenyl]carbamothioylamino]butanoate |
| SMILES | CCOC(=O)CCC(=O)NC(=S)Nc1ccc(OCC2CCCO2)cc1 |
| InChI | InChI=1S/C18H24N2O5S/c1-2-23-17(22)10-9-16(21)20-18(26)19-13-5-7-14(8-6-13)25-12-15-4-3-11-24-15/h5-8,15H,2-4,9-12H2,1H3,(H2,19,20,21,26) |
| InChIKey | NZLOFZSSZVDICQ-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.47 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|