C29H38N2O7 — CID 58408911
5-(2,2-dimethylpropanoyl)-N-[4-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]phenyl]-1H-indole-2-carboxamide (PubChem CID 58408911) has the molecular formula C29H38N2O7 and a molecular weight of 526.63 g/mol. Its IUPAC name is 5-(2,2-dimethylpropanoyl)-N-[4-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]phenyl]-1H-indole-2-carboxamide.
| Compound Name | 5-(2,2-dimethylpropanoyl)-N-[4-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]phenyl]-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 58408911 |
| Molecular Formula | C29H38N2O7 |
| Molecular Weight | 526.63 g/mol |
| Exact Mass | 526.27 |
| IUPAC Name | 5-(2,2-dimethylpropanoyl)-N-[4-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]phenyl]-1H-indole-2-carboxamide |
| SMILES | COCCOCCOCCOCCOc1ccc(NC(=O)c2cc3cc(C(=O)C(C)(C)C)ccc3[nH]2)cc1 |
| InChI | InChI=1S/C29H38N2O7/c1-29(2,3)27(32)21-5-10-25-22(19-21)20-26(31-25)28(33)30-23-6-8-24(9-7-23)38-18-17-37-16-15-36-14-13-35-12-11-34-4/h5-10,19-20,31H,11-18H2,1-4H3,(H,30,33) |
| InChIKey | QTJQTMDCIYZFNS-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 108.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.63 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|