C29H31N3O5 — CID 58409034
N-[4-[6-(2,2-dimethylpropanoyl)-1H-benzimidazol-2-yl]phenyl]-4-[2-(2-hydroxyethoxy)ethoxy]benzamide (PubChem CID 58409034) has the molecular formula C29H31N3O5 and a molecular weight of 501.58 g/mol. Its IUPAC name is N-[4-[6-(2,2-dimethylpropanoyl)-1H-benzimidazol-2-yl]phenyl]-4-[2-(2-hydroxyethoxy)ethoxy]benzamide.
| Compound Name | N-[4-[6-(2,2-dimethylpropanoyl)-1H-benzimidazol-2-yl]phenyl]-4-[2-(2-hydroxyethoxy)ethoxy]benzamide |
|---|---|
| PubChem CID | 58409034 |
| Molecular Formula | C29H31N3O5 |
| Molecular Weight | 501.58 g/mol |
| Exact Mass | 501.23 |
| IUPAC Name | N-[4-[6-(2,2-dimethylpropanoyl)-1H-benzimidazol-2-yl]phenyl]-4-[2-(2-hydroxyethoxy)ethoxy]benzamide |
| SMILES | CC(C)(C)C(=O)c1ccc2nc(-c3ccc(NC(=O)c4ccc(OCCOCCO)cc4)cc3)[nH]c2c1 |
| InChI | InChI=1S/C29H31N3O5/c1-29(2,3)26(34)21-8-13-24-25(18-21)32-27(31-24)19-4-9-22(10-5-19)30-28(35)20-6-11-23(12-7-20)37-17-16-36-15-14-33/h4-13,18,33H,14-17H2,1-3H3,(H,30,35)(H,31,32) |
| InChIKey | RKOVKDMXCLNOOT-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 113.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.58 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|