C24H23N3O5 — CID 123626477
methyl 4-[[hydroxy-[2-[4-(2-hydroxyethoxy)phenyl]-3H-benzimidazol-5-yl]methyl]amino]benzoate (PubChem CID 123626477) has the molecular formula C24H23N3O5 and a molecular weight of 433.46 g/mol. Its IUPAC name is methyl 4-[[hydroxy-[2-[4-(2-hydroxyethoxy)phenyl]-3H-benzimidazol-5-yl]methyl]amino]benzoate.
| Compound Name | methyl 4-[[hydroxy-[2-[4-(2-hydroxyethoxy)phenyl]-3H-benzimidazol-5-yl]methyl]amino]benzoate |
|---|---|
| PubChem CID | 123626477 |
| Molecular Formula | C24H23N3O5 |
| Molecular Weight | 433.46 g/mol |
| Exact Mass | 433.16 |
| IUPAC Name | methyl 4-[[hydroxy-[2-[4-(2-hydroxyethoxy)phenyl]-3H-benzimidazol-5-yl]methyl]amino]benzoate |
| SMILES | COC(=O)c1ccc(NC(O)c2ccc3nc(-c4ccc(OCCO)cc4)[nH]c3c2)cc1 |
| InChI | InChI=1S/C24H23N3O5/c1-31-24(30)16-2-7-18(8-3-16)25-23(29)17-6-11-20-21(14-17)27-22(26-20)15-4-9-19(10-5-15)32-13-12-28/h2-11,14,23,25,28-29H,12-13H2,1H3,(H,26,27) |
| InChIKey | ZWRQOAVAVHRRCX-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 116.70 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.46 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|