C25H24ClN3O2 — CID 54858428
4-butoxy-N-[4-(5-chloro-6-methyl-1H-benzimidazol-2-yl)phenyl]benzamide (PubChem CID 54858428) has the molecular formula C25H24ClN3O2 and a molecular weight of 433.94 g/mol. Its IUPAC name is 4-butoxy-N-[4-(5-chloro-6-methyl-1H-benzimidazol-2-yl)phenyl]benzamide.
| Compound Name | 4-butoxy-N-[4-(5-chloro-6-methyl-1H-benzimidazol-2-yl)phenyl]benzamide |
|---|---|
| PubChem CID | 54858428 |
| Molecular Formula | C25H24ClN3O2 |
| Molecular Weight | 433.94 g/mol |
| Exact Mass | 433.16 |
| IUPAC Name | 4-butoxy-N-[4-(5-chloro-6-methyl-1H-benzimidazol-2-yl)phenyl]benzamide |
| SMILES | CCCCOc1ccc(C(=O)Nc2ccc(-c3nc4cc(Cl)c(C)cc4[nH]3)cc2)cc1 |
| InChI | InChI=1S/C25H24ClN3O2/c1-3-4-13-31-20-11-7-18(8-12-20)25(30)27-19-9-5-17(6-10-19)24-28-22-14-16(2)21(26)15-23(22)29-24/h5-12,14-15H,3-4,13H2,1-2H3,(H,27,30)(H,28,29) |
| InChIKey | BLUISZAPWUAMPU-UHFFFAOYSA-N |
| XLogP | 6.62 |
| TPSA | 67.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.94 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|