C18H17FN2O3 — CID 46433700
5-fluoro-N-[4-(2-methoxyethoxy)phenyl]-1H-indole-2-carboxamide (PubChem CID 46433700) has the molecular formula C18H17FN2O3 and a molecular weight of 328.34 g/mol. Its IUPAC name is 5-fluoro-N-[4-(2-methoxyethoxy)phenyl]-1H-indole-2-carboxamide.
| Compound Name | 5-fluoro-N-[4-(2-methoxyethoxy)phenyl]-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 46433700 |
| Molecular Formula | C18H17FN2O3 |
| Molecular Weight | 328.34 g/mol |
| Exact Mass | 328.12 |
| IUPAC Name | 5-fluoro-N-[4-(2-methoxyethoxy)phenyl]-1H-indole-2-carboxamide |
| SMILES | COCCOc1ccc(NC(=O)c2cc3cc(F)ccc3[nH]2)cc1 |
| InChI | InChI=1S/C18H17FN2O3/c1-23-8-9-24-15-5-3-14(4-6-15)20-18(22)17-11-12-10-13(19)2-7-16(12)21-17/h2-7,10-11,21H,8-9H2,1H3,(H,20,22) |
| InChIKey | PMZDUVJAFAHRPQ-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 63.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.34 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|