C12H14FNO2 — CID 62060048
(4-fluorophenyl)-(1,4-oxazepan-4-yl)methanone (PubChem CID 62060048) has the molecular formula C12H14FNO2 and a molecular weight of 223.25 g/mol. Its IUPAC name is (4-fluorophenyl)-(1,4-oxazepan-4-yl)methanone.
| Compound Name | (4-fluorophenyl)-(1,4-oxazepan-4-yl)methanone |
|---|---|
| PubChem CID | 62060048 |
| Molecular Formula | C12H14FNO2 |
| Molecular Weight | 223.25 g/mol |
| Exact Mass | 223.10 |
| IUPAC Name | (4-fluorophenyl)-(1,4-oxazepan-4-yl)methanone |
| SMILES | O=C(c1ccc(F)cc1)N1CCCOCC1 |
| InChI | InChI=1S/C12H14FNO2/c13-11-4-2-10(3-5-11)12(15)14-6-1-8-16-9-7-14/h2-5H,1,6-9H2 |
| InChIKey | FJECEHQHZXWVAM-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.25 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |