C12H12FNO3 — CID 82116829
1-(4-fluorophenyl)-2-morpholin-4-ylethane-1,2-dione (PubChem CID 82116829) has the molecular formula C12H12FNO3 and a molecular weight of 237.23 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-2-morpholin-4-ylethane-1,2-dione.
| Compound Name | 1-(4-fluorophenyl)-2-morpholin-4-ylethane-1,2-dione |
|---|---|
| PubChem CID | 82116829 |
| Molecular Formula | C12H12FNO3 |
| Molecular Weight | 237.23 g/mol |
| Exact Mass | 237.08 |
| IUPAC Name | 1-(4-fluorophenyl)-2-morpholin-4-ylethane-1,2-dione |
| SMILES | O=C(C(=O)N1CCOCC1)c1ccc(F)cc1 |
| InChI | InChI=1S/C12H12FNO3/c13-10-3-1-9(2-4-10)11(15)12(16)14-5-7-17-8-6-14/h1-4H,5-8H2 |
| InChIKey | KYABKMBNLAHGFI-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.23 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|