C11H13FN2O2 — CID 63979575
(6-fluoro-3-pyridinyl)-(1,4-oxazepan-4-yl)methanone (PubChem CID 63979575) has the molecular formula C11H13FN2O2 and a molecular weight of 224.23 g/mol. Its IUPAC name is (6-fluoro-3-pyridinyl)-(1,4-oxazepan-4-yl)methanone.
| Compound Name | (6-fluoro-3-pyridinyl)-(1,4-oxazepan-4-yl)methanone |
|---|---|
| PubChem CID | 63979575 |
| Molecular Formula | C11H13FN2O2 |
| Molecular Weight | 224.23 g/mol |
| Exact Mass | 224.10 |
| IUPAC Name | (6-fluoro-3-pyridinyl)-(1,4-oxazepan-4-yl)methanone |
| SMILES | O=C(c1ccc(F)nc1)N1CCCOCC1 |
| InChI | InChI=1S/C11H13FN2O2/c12-10-3-2-9(8-13-10)11(15)14-4-1-6-16-7-5-14/h2-3,8H,1,4-7H2 |
| InChIKey | ZOLJXGZPLJUAHO-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.23 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|