C24H24Cl2N6O4 — CID 70102218
N-[4-[bis(2-chloroethyl)amino]-3-methoxyphenyl]-2-(1-methyl-4-nitropyrrol-2-yl)-3H-benzimidazole-5-carboxamide (PubChem CID 70102218) has the molecular formula C24H24Cl2N6O4 and a molecular weight of 531.40 g/mol. Its IUPAC name is N-[4-[bis(2-chloroethyl)amino]-3-methoxyphenyl]-2-(1-methyl-4-nitropyrrol-2-yl)-3H-benzimidazole-5-carboxamide.
| Compound Name | N-[4-[bis(2-chloroethyl)amino]-3-methoxyphenyl]-2-(1-methyl-4-nitropyrrol-2-yl)-3H-benzimidazole-5-carboxamide |
|---|---|
| PubChem CID | 70102218 |
| Molecular Formula | C24H24Cl2N6O4 |
| Molecular Weight | 531.40 g/mol |
| Exact Mass | 530.12 |
| IUPAC Name | N-[4-[bis(2-chloroethyl)amino]-3-methoxyphenyl]-2-(1-methyl-4-nitropyrrol-2-yl)-3H-benzimidazole-5-carboxamide |
| SMILES | COc1cc(NC(=O)c2ccc3nc(-c4cc([N+](=O)[O-])cn4C)[nH]c3c2)ccc1N(CCCl)CCCl |
| InChI | InChI=1S/C24H24Cl2N6O4/c1-30-14-17(32(34)35)13-21(30)23-28-18-5-3-15(11-19(18)29-23)24(33)27-16-4-6-20(22(12-16)36-2)31(9-7-25)10-8-26/h3-6,11-14H,7-10H2,1-2H3,(H,27,33)(H,28,29) |
| InChIKey | KPUWANURKPDWEW-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 118.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.40 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|