C28H32Cl2N6O2 — CID 67752719
4-[bis(2-chloroethyl)amino]-N-[1-methyl-5-[6-(pentanoylamino)-1H-benzimidazol-2-yl]pyrrol-3-yl]benzamide (PubChem CID 67752719) has the molecular formula C28H32Cl2N6O2 and a molecular weight of 555.51 g/mol. Its IUPAC name is 4-[bis(2-chloroethyl)amino]-N-[1-methyl-5-[6-(pentanoylamino)-1H-benzimidazol-2-yl]pyrrol-3-yl]benzamide.
| Compound Name | 4-[bis(2-chloroethyl)amino]-N-[1-methyl-5-[6-(pentanoylamino)-1H-benzimidazol-2-yl]pyrrol-3-yl]benzamide |
|---|---|
| PubChem CID | 67752719 |
| Molecular Formula | C28H32Cl2N6O2 |
| Molecular Weight | 555.51 g/mol |
| Exact Mass | 554.20 |
| IUPAC Name | 4-[bis(2-chloroethyl)amino]-N-[1-methyl-5-[6-(pentanoylamino)-1H-benzimidazol-2-yl]pyrrol-3-yl]benzamide |
| SMILES | CCCCC(=O)Nc1ccc2nc(-c3cc(NC(=O)c4ccc(N(CCCl)CCCl)cc4)cn3C)[nH]c2c1 |
| InChI | InChI=1S/C28H32Cl2N6O2/c1-3-4-5-26(37)31-20-8-11-23-24(16-20)34-27(33-23)25-17-21(18-35(25)2)32-28(38)19-6-9-22(10-7-19)36(14-12-29)15-13-30/h6-11,16-18H,3-5,12-15H2,1-2H3,(H,31,37)(H,32,38)(H,33,34) |
| InChIKey | QXYLPDZNXAJONZ-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 95.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.51 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|