C37H46Cl2N8O4 — CID 139702605
N-[4-[[5-[[4-[bis(2-chloroethyl)amino]phenyl]carbamoyl]-1-methylpyrrol-3-yl]carbamoyl]phenyl]-4-[4-(diethylamino)butanoylamino]-1-methylpyrrole-2-carboxamide (PubChem CID 139702605) has the molecular formula C37H46Cl2N8O4 and a molecular weight of 737.73 g/mol. Its IUPAC name is N-[4-[[5-[[4-[bis(2-chloroethyl)amino]phenyl]carbamoyl]-1-methylpyrrol-3-yl]carbamoyl]phenyl]-4-[4-(diethylamino)butanoylamino]-1-methylpyrrole-2-carboxamide.
| Compound Name | N-[4-[[5-[[4-[bis(2-chloroethyl)amino]phenyl]carbamoyl]-1-methylpyrrol-3-yl]carbamoyl]phenyl]-4-[4-(diethylamino)butanoylamino]-1-methylpyrrole-2-carboxamide |
|---|---|
| PubChem CID | 139702605 |
| Molecular Formula | C37H46Cl2N8O4 |
| Molecular Weight | 737.73 g/mol |
| Exact Mass | 736.30 |
| IUPAC Name | N-[4-[[5-[[4-[bis(2-chloroethyl)amino]phenyl]carbamoyl]-1-methylpyrrol-3-yl]carbamoyl]phenyl]-4-[4-(diethylamino)butanoylamino]-1-methylpyrrole-2-carboxamide |
| SMILES | CCN(CC)CCCC(=O)Nc1cc(C(=O)Nc2ccc(C(=O)Nc3cc(C(=O)Nc4ccc(N(CCCl)CCCl)cc4)n(C)c3)cc2)n(C)c1 |
| InChI | InChI=1S/C37H46Cl2N8O4/c1-5-46(6-2)19-7-8-34(48)40-29-22-32(44(3)24-29)36(50)41-27-11-9-26(10-12-27)35(49)43-30-23-33(45(4)25-30)37(51)42-28-13-15-31(16-14-28)47(20-17-38)21-18-39/h9-16,22-25H,5-8,17-21H2,1-4H3,(H,40,48)(H,41,50)(H,42,51)(H,43,49) |
| InChIKey | PYYBPAAUXALNFS-UHFFFAOYSA-N |
| XLogP | 6.47 |
| TPSA | 132.74 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 737.73 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|