C30H30Cl2N6O3 — CID 139702590
N-[4-[bis(2-chloroethyl)amino]phenyl]-1-methyl-4-[[3-[(2-pyridin-4-ylacetyl)amino]benzoyl]amino]pyrrole-2-carboxamide (PubChem CID 139702590) has the molecular formula C30H30Cl2N6O3 and a molecular weight of 593.52 g/mol. Its IUPAC name is N-[4-[bis(2-chloroethyl)amino]phenyl]-1-methyl-4-[[3-[(2-pyridin-4-ylacetyl)amino]benzoyl]amino]pyrrole-2-carboxamide.
| Compound Name | N-[4-[bis(2-chloroethyl)amino]phenyl]-1-methyl-4-[[3-[(2-pyridin-4-ylacetyl)amino]benzoyl]amino]pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 139702590 |
| Molecular Formula | C30H30Cl2N6O3 |
| Molecular Weight | 593.52 g/mol |
| Exact Mass | 592.18 |
| IUPAC Name | N-[4-[bis(2-chloroethyl)amino]phenyl]-1-methyl-4-[[3-[(2-pyridin-4-ylacetyl)amino]benzoyl]amino]pyrrole-2-carboxamide |
| SMILES | Cn1cc(NC(=O)c2cccc(NC(=O)Cc3ccncc3)c2)cc1C(=O)Nc1ccc(N(CCCl)CCCl)cc1 |
| InChI | InChI=1S/C30H30Cl2N6O3/c1-37-20-25(19-27(37)30(41)35-23-5-7-26(8-6-23)38(15-11-31)16-12-32)36-29(40)22-3-2-4-24(18-22)34-28(39)17-21-9-13-33-14-10-21/h2-10,13-14,18-20H,11-12,15-17H2,1H3,(H,34,39)(H,35,41)(H,36,40) |
| InChIKey | KXIXRNLKWDLYCZ-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 108.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.52 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|