C22H28Cl2N4O2 — CID 158072926
2-[4-[bis(2-chloroethyl)amino]phenyl]-N-[4-[[2-(dimethylamino)acetyl]amino]phenyl]acetamide (PubChem CID 158072926) has the molecular formula C22H28Cl2N4O2 and a molecular weight of 451.40 g/mol. Its IUPAC name is 2-[4-[bis(2-chloroethyl)amino]phenyl]-N-[4-[[2-(dimethylamino)acetyl]amino]phenyl]acetamide.
| Compound Name | 2-[4-[bis(2-chloroethyl)amino]phenyl]-N-[4-[[2-(dimethylamino)acetyl]amino]phenyl]acetamide |
|---|---|
| PubChem CID | 158072926 |
| Molecular Formula | C22H28Cl2N4O2 |
| Molecular Weight | 451.40 g/mol |
| Exact Mass | 450.16 |
| IUPAC Name | 2-[4-[bis(2-chloroethyl)amino]phenyl]-N-[4-[[2-(dimethylamino)acetyl]amino]phenyl]acetamide |
| SMILES | CN(C)CC(=O)Nc1ccc(NC(=O)Cc2ccc(N(CCCl)CCCl)cc2)cc1 |
| InChI | InChI=1S/C22H28Cl2N4O2/c1-27(2)16-22(30)26-19-7-5-18(6-8-19)25-21(29)15-17-3-9-20(10-4-17)28(13-11-23)14-12-24/h3-10H,11-16H2,1-2H3,(H,25,29)(H,26,30) |
| InChIKey | CRPMSXGRPAIRRR-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.40 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|