C22H24Cl2FeN2O — CID 3052345
2-[4-[bis(2-chloroethyl)amino]phenyl]-N-cyclopenta-1,4-dien-1-ylacetamide;cyclopenta-1,3-diene;iron(2+) (PubChem CID 3052345) has the molecular formula C22H24Cl2FeN2O and a molecular weight of 459.20 g/mol. Its IUPAC name is 2-[4-[bis(2-chloroethyl)amino]phenyl]-N-cyclopenta-1,4-dien-1-ylacetamide;cyclopenta-1,3-diene;iron(2+).
| Compound Name | 2-[4-[bis(2-chloroethyl)amino]phenyl]-N-cyclopenta-1,4-dien-1-ylacetamide;cyclopenta-1,3-diene;iron(2+) |
|---|---|
| PubChem CID | 3052345 |
| Molecular Formula | C22H24Cl2FeN2O |
| Molecular Weight | 459.20 g/mol |
| Exact Mass | 458.06 |
| IUPAC Name | 2-[4-[bis(2-chloroethyl)amino]phenyl]-N-cyclopenta-1,4-dien-1-ylacetamide;cyclopenta-1,3-diene;iron(2+) |
| SMILES | O=C(Cc1ccc(N(CCCl)CCCl)cc1)Nc1cc[cH-]c1.[Fe+2].c1cc[cH-]c1 |
| InChI | InChI=1S/C17H19Cl2N2O.C5H5.Fe/c18-9-11-21(12-10-19)16-7-5-14(6-8-16)13-17(22)20-15-3-1-2-4-15;1-2-4-5-3-1;/h1-8H,9-13H2,(H,20,22);1-5H;/q2*-1;+2 |
| InChIKey | BTGYYWWGEUMBTK-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.20 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|